C20H31ClN2O4 — CID 122042957
2-[[1-[(3-chloro-5-ethoxy-4-propoxyphenyl)methyl]piperidin-4-yl]-methylamino]acetic acid (PubChem CID 122042957) has the molecular formula C20H31ClN2O4 and a molecular weight of 398.93 g/mol. Its IUPAC name is 2-[[1-[(3-chloro-5-ethoxy-4-propoxyphenyl)methyl]piperidin-4-yl]-methylamino]acetic acid.
| Compound Name | 2-[[1-[(3-chloro-5-ethoxy-4-propoxyphenyl)methyl]piperidin-4-yl]-methylamino]acetic acid |
|---|---|
| PubChem CID | 122042957 |
| Molecular Formula | C20H31ClN2O4 |
| Molecular Weight | 398.93 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | 2-[[1-[(3-chloro-5-ethoxy-4-propoxyphenyl)methyl]piperidin-4-yl]-methylamino]acetic acid |
| SMILES | CCCOc1c(Cl)cc(CN2CCC(N(C)CC(=O)O)CC2)cc1OCC |
| InChI | InChI=1S/C20H31ClN2O4/c1-4-10-27-20-17(21)11-15(12-18(20)26-5-2)13-23-8-6-16(7-9-23)22(3)14-19(24)25/h11-12,16H,4-10,13-14H2,1-3H3,(H,24,25) |
| InChIKey | QDFZAGSJORQTHL-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.93 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |