C13H15FN2O3 — CID 122049252
(2R)-2-[(4-fluoro-1,3-benzoxazol-2-yl)amino]-4-methylpentanoic acid (PubChem CID 122049252) has the molecular formula C13H15FN2O3 and a molecular weight of 266.27 g/mol. Its IUPAC name is (2R)-2-[(4-fluoro-1,3-benzoxazol-2-yl)amino]-4-methylpentanoic acid.
| Compound Name | (2R)-2-[(4-fluoro-1,3-benzoxazol-2-yl)amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 122049252 |
| Molecular Formula | C13H15FN2O3 |
| Molecular Weight | 266.27 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | (2R)-2-[(4-fluoro-1,3-benzoxazol-2-yl)amino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@@H](Nc1nc2c(F)cccc2o1)C(=O)O |
| InChI | InChI=1S/C13H15FN2O3/c1-7(2)6-9(12(17)18)15-13-16-11-8(14)4-3-5-10(11)19-13/h3-5,7,9H,6H2,1-2H3,(H,15,16)(H,17,18)/t9-/m1/s1 |
| InChIKey | JYBLRCBPVSKVIF-SECBINFHSA-N |
| XLogP | 2.88 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.27 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |