C15H18N2O3 — CID 122051472
2-[[3-(hydroxymethyl)quinolin-2-yl]-propylamino]acetic acid (PubChem CID 122051472) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is 2-[[3-(hydroxymethyl)quinolin-2-yl]-propylamino]acetic acid.
| Compound Name | 2-[[3-(hydroxymethyl)quinolin-2-yl]-propylamino]acetic acid |
|---|---|
| PubChem CID | 122051472 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 2-[[3-(hydroxymethyl)quinolin-2-yl]-propylamino]acetic acid |
| SMILES | CCCN(CC(=O)O)c1nc2ccccc2cc1CO |
| InChI | InChI=1S/C15H18N2O3/c1-2-7-17(9-14(19)20)15-12(10-18)8-11-5-3-4-6-13(11)16-15/h3-6,8,18H,2,7,9-10H2,1H3,(H,19,20) |
| InChIKey | ZILLYMNEJOVYFC-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 73.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |