C16H19NO3 — CID 176897320
2-[3-(hydroxymethyl)quinolin-2-yl]hexanoic acid (PubChem CID 176897320) has the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. Its IUPAC name is 2-[3-(hydroxymethyl)quinolin-2-yl]hexanoic acid.
| Compound Name | 2-[3-(hydroxymethyl)quinolin-2-yl]hexanoic acid |
|---|---|
| PubChem CID | 176897320 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | 2-[3-(hydroxymethyl)quinolin-2-yl]hexanoic acid |
| SMILES | CCCCC(C(=O)O)c1nc2ccccc2cc1CO |
| InChI | InChI=1S/C16H19NO3/c1-2-3-7-13(16(19)20)15-12(10-18)9-11-6-4-5-8-14(11)17-15/h4-6,8-9,13,18H,2-3,7,10H2,1H3,(H,19,20) |
| InChIKey | MWHHYDWGFISVTB-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |