C15H11NO8 — CID 174339019
2-[2-(dicarboxymethyl)quinolin-3-yl]propanedioic acid (PubChem CID 174339019) has the molecular formula C15H11NO8 and a molecular weight of 333.25 g/mol. Its IUPAC name is 2-[2-(dicarboxymethyl)quinolin-3-yl]propanedioic acid.
| Compound Name | 2-[2-(dicarboxymethyl)quinolin-3-yl]propanedioic acid |
|---|---|
| PubChem CID | 174339019 |
| Molecular Formula | C15H11NO8 |
| Molecular Weight | 333.25 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | 2-[2-(dicarboxymethyl)quinolin-3-yl]propanedioic acid |
| SMILES | O=C(O)C(C(=O)O)c1cc2ccccc2nc1C(C(=O)O)C(=O)O |
| InChI | InChI=1S/C15H11NO8/c17-12(18)9(13(19)20)7-5-6-3-1-2-4-8(6)16-11(7)10(14(21)22)15(23)24/h1-5,9-10H,(H,17,18)(H,19,20)(H,21,22)(H,23,24) |
| InChIKey | QLGOQSUPUVGWEO-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 162.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.25 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|