C12H10O8 — CID 141274260
2-[2-(dicarboxymethyl)phenyl]propanedioic acid (PubChem CID 141274260) has the molecular formula C12H10O8 and a molecular weight of 282.20 g/mol. Its IUPAC name is 2-[2-(dicarboxymethyl)phenyl]propanedioic acid.
| Compound Name | 2-[2-(dicarboxymethyl)phenyl]propanedioic acid |
|---|---|
| PubChem CID | 141274260 |
| Molecular Formula | C12H10O8 |
| Molecular Weight | 282.20 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | 2-[2-(dicarboxymethyl)phenyl]propanedioic acid |
| SMILES | O=C(O)C(C(=O)O)c1ccccc1C(C(=O)O)C(=O)O |
| InChI | InChI=1S/C12H10O8/c13-9(14)7(10(15)16)5-3-1-2-4-6(5)8(11(17)18)12(19)20/h1-4,7-8H,(H,13,14)(H,15,16)(H,17,18)(H,19,20) |
| InChIKey | IEBUMJAWJYDDBC-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.20 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|