C23H25O5P — CID 57138738
2-[2-[benzyl(hydroxy)phosphoryl]oxynaphthalen-1-yl]hexanoic acid (PubChem CID 57138738) has the molecular formula C23H25O5P and a molecular weight of 412.42 g/mol. Its IUPAC name is 2-[2-[benzyl(hydroxy)phosphoryl]oxynaphthalen-1-yl]hexanoic acid.
| Compound Name | 2-[2-[benzyl(hydroxy)phosphoryl]oxynaphthalen-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 57138738 |
| Molecular Formula | C23H25O5P |
| Molecular Weight | 412.42 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | 2-[2-[benzyl(hydroxy)phosphoryl]oxynaphthalen-1-yl]hexanoic acid |
| SMILES | CCCCC(C(=O)O)c1c(OP(=O)(O)Cc2ccccc2)ccc2ccccc12 |
| InChI | InChI=1S/C23H25O5P/c1-2-3-12-20(23(24)25)22-19-13-8-7-11-18(19)14-15-21(22)28-29(26,27)16-17-9-5-4-6-10-17/h4-11,13-15,20H,2-3,12,16H2,1H3,(H,24,25)(H,26,27) |
| InChIKey | BYADLOGLMYENTK-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.42 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|