C16H23O6P — CID 150060824
2-[1-[benzyl(hydroxy)phosphoryl]hexan-2-yl]propanedioic acid (PubChem CID 150060824) has the molecular formula C16H23O6P and a molecular weight of 342.33 g/mol. Its IUPAC name is 2-[1-[benzyl(hydroxy)phosphoryl]hexan-2-yl]propanedioic acid.
| Compound Name | 2-[1-[benzyl(hydroxy)phosphoryl]hexan-2-yl]propanedioic acid |
|---|---|
| PubChem CID | 150060824 |
| Molecular Formula | C16H23O6P |
| Molecular Weight | 342.33 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 2-[1-[benzyl(hydroxy)phosphoryl]hexan-2-yl]propanedioic acid |
| SMILES | CCCCC(CP(=O)(O)Cc1ccccc1)C(C(=O)O)C(=O)O |
| InChI | InChI=1S/C16H23O6P/c1-2-3-9-13(14(15(17)18)16(19)20)11-23(21,22)10-12-7-5-4-6-8-12/h4-8,13-14H,2-3,9-11H2,1H3,(H,17,18)(H,19,20)(H,21,22) |
| InChIKey | DNGJKBQKTXTDGF-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.33 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|