C13H19N3O4 — CID 122053930
5-[3-(oxolan-3-ylmethoxy)propylamino]pyrazine-2-carboxylic acid (PubChem CID 122053930) has the molecular formula C13H19N3O4 and a molecular weight of 281.31 g/mol. Its IUPAC name is 5-[3-(oxolan-3-ylmethoxy)propylamino]pyrazine-2-carboxylic acid.
| Compound Name | 5-[3-(oxolan-3-ylmethoxy)propylamino]pyrazine-2-carboxylic acid |
|---|---|
| PubChem CID | 122053930 |
| Molecular Formula | C13H19N3O4 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 5-[3-(oxolan-3-ylmethoxy)propylamino]pyrazine-2-carboxylic acid |
| SMILES | O=C(O)c1cnc(NCCCOCC2CCOC2)cn1 |
| InChI | InChI=1S/C13H19N3O4/c17-13(18)11-6-16-12(7-15-11)14-3-1-4-19-8-10-2-5-20-9-10/h6-7,10H,1-5,8-9H2,(H,14,16)(H,17,18) |
| InChIKey | IRDFIQRBHAEUSE-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|