C14H15N5O2 — CID 122057032
5-[ethyl-[(1-prop-2-ynylpyrazol-3-yl)methyl]amino]pyrazine-2-carboxylic acid (PubChem CID 122057032) has the molecular formula C14H15N5O2 and a molecular weight of 285.31 g/mol. Its IUPAC name is 5-[ethyl-[(1-prop-2-ynylpyrazol-3-yl)methyl]amino]pyrazine-2-carboxylic acid.
| Compound Name | 5-[ethyl-[(1-prop-2-ynylpyrazol-3-yl)methyl]amino]pyrazine-2-carboxylic acid |
|---|---|
| PubChem CID | 122057032 |
| Molecular Formula | C14H15N5O2 |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 5-[ethyl-[(1-prop-2-ynylpyrazol-3-yl)methyl]amino]pyrazine-2-carboxylic acid |
| SMILES | C#CCn1ccc(CN(CC)c2cnc(C(=O)O)cn2)n1 |
| InChI | InChI=1S/C14H15N5O2/c1-3-6-19-7-5-11(17-19)10-18(4-2)13-9-15-12(8-16-13)14(20)21/h1,5,7-9H,4,6,10H2,2H3,(H,20,21) |
| InChIKey | IWQZIYRIXIEDNV-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|