C15H15Cl2N3O2 — CID 122060005
4-[(6,7-dichloroquinoxalin-2-yl)amino]cyclohexane-1-carboxylic acid (PubChem CID 122060005) has the molecular formula C15H15Cl2N3O2 and a molecular weight of 340.21 g/mol. Its IUPAC name is 4-[(6,7-dichloroquinoxalin-2-yl)amino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[(6,7-dichloroquinoxalin-2-yl)amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 122060005 |
| Molecular Formula | C15H15Cl2N3O2 |
| Molecular Weight | 340.21 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | 4-[(6,7-dichloroquinoxalin-2-yl)amino]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(Nc2cnc3cc(Cl)c(Cl)cc3n2)CC1 |
| InChI | InChI=1S/C15H15Cl2N3O2/c16-10-5-12-13(6-11(10)17)20-14(7-18-12)19-9-3-1-8(2-4-9)15(21)22/h5-9H,1-4H2,(H,19,20)(H,21,22) |
| InChIKey | XHFFUVAXAPIXHS-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.21 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |