C19H22FN3O2 — CID 122061484
2-[cyclopropylmethyl-[3-[(7-fluoroisoquinolin-1-yl)amino]cyclobutyl]amino]acetic acid (PubChem CID 122061484) has the molecular formula C19H22FN3O2 and a molecular weight of 343.40 g/mol. Its IUPAC name is 2-[cyclopropylmethyl-[3-[(7-fluoroisoquinolin-1-yl)amino]cyclobutyl]amino]acetic acid.
| Compound Name | 2-[cyclopropylmethyl-[3-[(7-fluoroisoquinolin-1-yl)amino]cyclobutyl]amino]acetic acid |
|---|---|
| PubChem CID | 122061484 |
| Molecular Formula | C19H22FN3O2 |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | 2-[cyclopropylmethyl-[3-[(7-fluoroisoquinolin-1-yl)amino]cyclobutyl]amino]acetic acid |
| SMILES | O=C(O)CN(CC1CC1)C1CC(Nc2nccc3ccc(F)cc23)C1 |
| InChI | InChI=1S/C19H22FN3O2/c20-14-4-3-13-5-6-21-19(17(13)7-14)22-15-8-16(9-15)23(11-18(24)25)10-12-1-2-12/h3-7,12,15-16H,1-2,8-11H2,(H,21,22)(H,24,25) |
| InChIKey | LPCSAOPSGGCARD-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |