C23H26N4O2 — CID 122062292
2-[ethyl-[1-(4-phenylquinazolin-2-yl)piperidin-4-yl]amino]acetic acid (PubChem CID 122062292) has the molecular formula C23H26N4O2 and a molecular weight of 390.49 g/mol. Its IUPAC name is 2-[ethyl-[1-(4-phenylquinazolin-2-yl)piperidin-4-yl]amino]acetic acid.
| Compound Name | 2-[ethyl-[1-(4-phenylquinazolin-2-yl)piperidin-4-yl]amino]acetic acid |
|---|---|
| PubChem CID | 122062292 |
| Molecular Formula | C23H26N4O2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | 2-[ethyl-[1-(4-phenylquinazolin-2-yl)piperidin-4-yl]amino]acetic acid |
| SMILES | CCN(CC(=O)O)C1CCN(c2nc(-c3ccccc3)c3ccccc3n2)CC1 |
| InChI | InChI=1S/C23H26N4O2/c1-2-26(16-21(28)29)18-12-14-27(15-13-18)23-24-20-11-7-6-10-19(20)22(25-23)17-8-4-3-5-9-17/h3-11,18H,2,12-16H2,1H3,(H,28,29) |
| InChIKey | OORQYDOXZXFRBX-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |