C14H19FN2O6S2 — CID 122068604
1-[2-[(4-fluorophenyl)sulfonyl-methylamino]ethylsulfonyl]pyrrolidine-3-carboxylic acid (PubChem CID 122068604) has the molecular formula C14H19FN2O6S2 and a molecular weight of 394.45 g/mol. Its IUPAC name is 1-[2-[(4-fluorophenyl)sulfonyl-methylamino]ethylsulfonyl]pyrrolidine-3-carboxylic acid.
| Compound Name | 1-[2-[(4-fluorophenyl)sulfonyl-methylamino]ethylsulfonyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122068604 |
| Molecular Formula | C14H19FN2O6S2 |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | 1-[2-[(4-fluorophenyl)sulfonyl-methylamino]ethylsulfonyl]pyrrolidine-3-carboxylic acid |
| SMILES | CN(CCS(=O)(=O)N1CCC(C(=O)O)C1)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H19FN2O6S2/c1-16(25(22,23)13-4-2-12(15)3-5-13)8-9-24(20,21)17-7-6-11(10-17)14(18)19/h2-5,11H,6-10H2,1H3,(H,18,19) |
| InChIKey | MQQXBSMPLHSDNE-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 112.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |