C13H16F3N3O4S — CID 122070740
(3aS,6aR)-2-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]sulfonyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid (PubChem CID 122070740) has the molecular formula C13H16F3N3O4S and a molecular weight of 367.35 g/mol. Its IUPAC name is (3aS,6aR)-2-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]sulfonyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aS,6aR)-2-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]sulfonyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 122070740 |
| Molecular Formula | C13H16F3N3O4S |
| Molecular Weight | 367.35 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | (3aS,6aR)-2-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]sulfonyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
| SMILES | O=C(O)[C@@]12CCC[C@H]1CN(S(=O)(=O)c1cnn(CC(F)(F)F)c1)C2 |
| InChI | InChI=1S/C13H16F3N3O4S/c14-13(15,16)8-18-6-10(4-17-18)24(22,23)19-5-9-2-1-3-12(9,7-19)11(20)21/h4,6,9H,1-3,5,7-8H2,(H,20,21)/t9-,12+/m0/s1 |
| InChIKey | FUMXLEGXNMKMHL-JOYOIKCWSA-N |
| XLogP | 1.32 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.35 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |