C12H18ClF3N4O2S — CID 120712775
2-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine;hydrochloride (PubChem CID 120712775) has the molecular formula C12H18ClF3N4O2S and a molecular weight of 374.82 g/mol. Its IUPAC name is 2-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine;hydrochloride.
| Compound Name | 2-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine;hydrochloride |
|---|---|
| PubChem CID | 120712775 |
| Molecular Formula | C12H18ClF3N4O2S |
| Molecular Weight | 374.82 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | 2-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine;hydrochloride |
| SMILES | Cl.NC1CCC2CN(S(=O)(=O)c3cnn(CC(F)(F)F)c3)CC12 |
| InChI | InChI=1S/C12H17F3N4O2S.ClH/c13-12(14,15)7-18-5-9(3-17-18)22(20,21)19-4-8-1-2-11(16)10(8)6-19;/h3,5,8,10-11H,1-2,4,6-7,16H2;1H |
| InChIKey | QKLZFBXYGYECLI-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.82 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |