C13H23NO7S — CID 122071596
2-hydroxy-3-[(1-methoxycarbonylcyclohexyl)methylsulfonylamino]-2-methylpropanoic acid (PubChem CID 122071596) has the molecular formula C13H23NO7S and a molecular weight of 337.39 g/mol. Its IUPAC name is 2-hydroxy-3-[(1-methoxycarbonylcyclohexyl)methylsulfonylamino]-2-methylpropanoic acid.
| Compound Name | 2-hydroxy-3-[(1-methoxycarbonylcyclohexyl)methylsulfonylamino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 122071596 |
| Molecular Formula | C13H23NO7S |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 2-hydroxy-3-[(1-methoxycarbonylcyclohexyl)methylsulfonylamino]-2-methylpropanoic acid |
| SMILES | COC(=O)C1(CS(=O)(=O)NCC(C)(O)C(=O)O)CCCCC1 |
| InChI | InChI=1S/C13H23NO7S/c1-12(18,10(15)16)8-14-22(19,20)9-13(11(17)21-2)6-4-3-5-7-13/h14,18H,3-9H2,1-2H3,(H,15,16) |
| InChIKey | GITBPQREBHQMEI-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 130.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |