C5H12N2O5S — CID 114806493
2-hydroxy-2-methyl-3-(methylsulfamoylamino)propanoic acid (PubChem CID 114806493) has the molecular formula C5H12N2O5S and a molecular weight of 212.23 g/mol. Its IUPAC name is 2-hydroxy-2-methyl-3-(methylsulfamoylamino)propanoic acid.
| Compound Name | 2-hydroxy-2-methyl-3-(methylsulfamoylamino)propanoic acid |
|---|---|
| PubChem CID | 114806493 |
| Molecular Formula | C5H12N2O5S |
| Molecular Weight | 212.23 g/mol |
| Exact Mass | 212.05 |
| IUPAC Name | 2-hydroxy-2-methyl-3-(methylsulfamoylamino)propanoic acid |
| SMILES | CNS(=O)(=O)NCC(C)(O)C(=O)O |
| InChI | InChI=1S/C5H12N2O5S/c1-5(10,4(8)9)3-7-13(11,12)6-2/h6-7,10H,3H2,1-2H3,(H,8,9) |
| InChIKey | CBBFMLQCVBZIRA-UHFFFAOYSA-N |
| XLogP | -2.12 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.23 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |