C8H18N2O5S — CID 114814696
2-hydroxy-2-methyl-3-(2-methylpropylsulfamoylamino)propanoic acid (PubChem CID 114814696) has the molecular formula C8H18N2O5S and a molecular weight of 254.31 g/mol. Its IUPAC name is 2-hydroxy-2-methyl-3-(2-methylpropylsulfamoylamino)propanoic acid.
| Compound Name | 2-hydroxy-2-methyl-3-(2-methylpropylsulfamoylamino)propanoic acid |
|---|---|
| PubChem CID | 114814696 |
| Molecular Formula | C8H18N2O5S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 2-hydroxy-2-methyl-3-(2-methylpropylsulfamoylamino)propanoic acid |
| SMILES | CC(C)CNS(=O)(=O)NCC(C)(O)C(=O)O |
| InChI | InChI=1S/C8H18N2O5S/c1-6(2)4-9-16(14,15)10-5-8(3,13)7(11)12/h6,9-10,13H,4-5H2,1-3H3,(H,11,12) |
| InChIKey | PWZROTAJEPAKJX-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |