C15H25N3O5S — CID 122071675
1-[2-cyanoethyl(2-methoxyethyl)sulfamoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid (PubChem CID 122071675) has the molecular formula C15H25N3O5S and a molecular weight of 359.45 g/mol. Its IUPAC name is 1-[2-cyanoethyl(2-methoxyethyl)sulfamoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid.
| Compound Name | 1-[2-cyanoethyl(2-methoxyethyl)sulfamoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 122071675 |
| Molecular Formula | C15H25N3O5S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 1-[2-cyanoethyl(2-methoxyethyl)sulfamoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
| SMILES | COCCN(CCC#N)S(=O)(=O)N1C(C(=O)O)CC2CCCCC21 |
| InChI | InChI=1S/C15H25N3O5S/c1-23-10-9-17(8-4-7-16)24(21,22)18-13-6-3-2-5-12(13)11-14(18)15(19)20/h12-14H,2-6,8-11H2,1H3,(H,19,20) |
| InChIKey | UVPLZXRONJZESO-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 110.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |