C16H19NO6S — CID 122072243
7-(3-ethoxycarbonylphenyl)sulfonyl-7-azabicyclo[2.2.1]heptane-2-carboxylic acid (PubChem CID 122072243) has the molecular formula C16H19NO6S and a molecular weight of 353.40 g/mol. Its IUPAC name is 7-(3-ethoxycarbonylphenyl)sulfonyl-7-azabicyclo[2.2.1]heptane-2-carboxylic acid.
| Compound Name | 7-(3-ethoxycarbonylphenyl)sulfonyl-7-azabicyclo[2.2.1]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 122072243 |
| Molecular Formula | C16H19NO6S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 7-(3-ethoxycarbonylphenyl)sulfonyl-7-azabicyclo[2.2.1]heptane-2-carboxylic acid |
| SMILES | CCOC(=O)c1cccc(S(=O)(=O)N2C3CCC2C(C(=O)O)C3)c1 |
| InChI | InChI=1S/C16H19NO6S/c1-2-23-16(20)10-4-3-5-12(8-10)24(21,22)17-11-6-7-14(17)13(9-11)15(18)19/h3-5,8,11,13-14H,2,6-7,9H2,1H3,(H,18,19) |
| InChIKey | VTSJGEKKJMBPIG-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |