About 7-(5-chloro-2,4-dimethoxyphenyl)sulfonyl-7-azabicyclo[2.2.1]heptane-2-carboxylic acid
7-(5-chloro-2,4-dimethoxyphenyl)sulfonyl-7-azabicyclo[2.2.1]heptane-2-carboxylic acid (PubChem CID 122072679) has the molecular formula C15H18ClNO6S
and a molecular weight of 375.83 g/mol. Its IUPAC name is 7-(5-chloro-2,4-dimethoxyphenyl)sulfonyl-7-azabicyclo[2.2.1]heptane-2-carboxylic acid.
Molecular Properties
| Compound Name | 7-(5-chloro-2,4-dimethoxyphenyl)sulfonyl-7-azabicyclo[2.2.1]heptane-2-carboxylic acid |
| PubChem CID | 122072679 |
| Molecular Formula | C15H18ClNO6S |
| Molecular Weight | 375.83 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | 7-(5-chloro-2,4-dimethoxyphenyl)sulfonyl-7-azabicyclo[2.2.1]heptane-2-carboxylic acid |
| SMILES | COc1cc(OC)c(S(=O)(=O)N2C3CCC2C(C(=O)O)C3)cc1Cl |
| InChI | InChI=1S/C15H18ClNO6S/c1-22-12-7-13(23-2)14(6-10(12)16)24(20,21)17-8-3-4-11(17)9(5-8)15(18)19/h6-9,11H,3-5H2,1-2H3,(H,18,19) |
| InChIKey | SFKMTMUGJZPRLU-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.83 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-(5-chloro-2,4-dimethoxyphenyl)sulfonyl-7-azabicyclo[2.2.1]heptane-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(5-chloro-2,4-dimethoxyphenyl)sulfonyl-7-azabicyclo[2.2.1]heptane-2-carboxylic acid?
The IUPAC name of 7-(5-chloro-2,4-dimethoxyphenyl)sulfonyl-7-azabicyclo[2.2.1]heptane-2-carboxylic acid (CID 122072679) is 7-(5-chloro-2,4-dimethoxyphenyl)sulfonyl-7-azabicyclo[2.2.1]heptane-2-carboxylic acid.
What is the SMILES notation for 7-(5-chloro-2,4-dimethoxyphenyl)sulfonyl-7-azabicyclo[2.2.1]heptane-2-carboxylic acid?
The canonical SMILES for 7-(5-chloro-2,4-dimethoxyphenyl)sulfonyl-7-azabicyclo[2.2.1]heptane-2-carboxylic acid is COc1cc(OC)c(S(=O)(=O)N2C3CCC2C(C(=O)O)C3)cc1Cl.
What is the InChIKey of 7-(5-chloro-2,4-dimethoxyphenyl)sulfonyl-7-azabicyclo[2.2.1]heptane-2-carboxylic acid?
The InChIKey is SFKMTMUGJZPRLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18ClNO6S/c1-22-12-7-13(23-2)14(6-10(12)16)24(20,21)17-8-3-4-11(17)9(5-8)15(18)19/h6-9,11H,3-5H2,1-2H3,(H,18,19).
What are the key properties of 7-(5-chloro-2,4-dimethoxyphenyl)sulfonyl-7-azabicyclo[2.2.1]heptane-2-carboxylic acid?
7-(5-chloro-2,4-dimethoxyphenyl)sulfonyl-7-azabicyclo[2.2.1]heptane-2-carboxylic acid has a molecular weight of 375.83 g/mol, XLogP of 1.98, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(5-chloro-2,4-dimethoxyphenyl)sulfonyl-7-azabicyclo[2.2.1]heptane-2-carboxylic acid is sourced from PubChem (CID 122072679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).