C13H13F2N3O5 — CID 122079232
3-[[5-cyano-2-(difluoromethoxy)phenyl]carbamoylamino]-2-hydroxy-2-methylpropanoic acid (PubChem CID 122079232) has the molecular formula C13H13F2N3O5 and a molecular weight of 329.26 g/mol. Its IUPAC name is 3-[[5-cyano-2-(difluoromethoxy)phenyl]carbamoylamino]-2-hydroxy-2-methylpropanoic acid.
| Compound Name | 3-[[5-cyano-2-(difluoromethoxy)phenyl]carbamoylamino]-2-hydroxy-2-methylpropanoic acid |
|---|---|
| PubChem CID | 122079232 |
| Molecular Formula | C13H13F2N3O5 |
| Molecular Weight | 329.26 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 3-[[5-cyano-2-(difluoromethoxy)phenyl]carbamoylamino]-2-hydroxy-2-methylpropanoic acid |
| SMILES | CC(O)(CNC(=O)Nc1cc(C#N)ccc1OC(F)F)C(=O)O |
| InChI | InChI=1S/C13H13F2N3O5/c1-13(22,10(19)20)6-17-12(21)18-8-4-7(5-16)2-3-9(8)23-11(14)15/h2-4,11,22H,6H2,1H3,(H,19,20)(H2,17,18,21) |
| InChIKey | HRILCFPREMBZBF-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 131.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.26 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |