C14H14F2N4O2 — CID 99703621
1-[(2R)-1-cyanobutan-2-yl]-3-[5-cyano-2-(difluoromethoxy)phenyl]urea (PubChem CID 99703621) has the molecular formula C14H14F2N4O2 and a molecular weight of 308.29 g/mol. Its IUPAC name is 1-[(2R)-1-cyanobutan-2-yl]-3-[5-cyano-2-(difluoromethoxy)phenyl]urea.
| Compound Name | 1-[(2R)-1-cyanobutan-2-yl]-3-[5-cyano-2-(difluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 99703621 |
| Molecular Formula | C14H14F2N4O2 |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 1-[(2R)-1-cyanobutan-2-yl]-3-[5-cyano-2-(difluoromethoxy)phenyl]urea |
| SMILES | CC[C@H](CC#N)NC(=O)Nc1cc(C#N)ccc1OC(F)F |
| InChI | InChI=1S/C14H14F2N4O2/c1-2-10(5-6-17)19-14(21)20-11-7-9(8-18)3-4-12(11)22-13(15)16/h3-4,7,10,13H,2,5H2,1H3,(H2,19,20,21)/t10-/m1/s1 |
| InChIKey | SIQBKJNJGPQBIM-SNVBAGLBSA-N |
| XLogP | 2.97 |
| TPSA | 97.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |