C17H13ClF2N2O3 — CID 9384005
(2R)-2-(2-chloro-4-cyanophenoxy)-N-[2-(difluoromethoxy)phenyl]propanamide (PubChem CID 9384005) has the molecular formula C17H13ClF2N2O3 and a molecular weight of 366.75 g/mol. Its IUPAC name is (2R)-2-(2-chloro-4-cyanophenoxy)-N-[2-(difluoromethoxy)phenyl]propanamide.
| Compound Name | (2R)-2-(2-chloro-4-cyanophenoxy)-N-[2-(difluoromethoxy)phenyl]propanamide |
|---|---|
| PubChem CID | 9384005 |
| Molecular Formula | C17H13ClF2N2O3 |
| Molecular Weight | 366.75 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | (2R)-2-(2-chloro-4-cyanophenoxy)-N-[2-(difluoromethoxy)phenyl]propanamide |
| SMILES | C[C@@H](Oc1ccc(C#N)cc1Cl)C(=O)Nc1ccccc1OC(F)F |
| InChI | InChI=1S/C17H13ClF2N2O3/c1-10(24-14-7-6-11(9-21)8-12(14)18)16(23)22-13-4-2-3-5-15(13)25-17(19)20/h2-8,10,17H,1H3,(H,22,23)/t10-/m1/s1 |
| InChIKey | NGYLIJNQRTZNOX-SNVBAGLBSA-N |
| XLogP | 4.22 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.75 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |