C19H21FN4O3S — CID 100665083
1-[(2R)-1-cyanobutan-2-yl]-3-[4-fluoro-2-methyl-5-(phenylsulfamoyl)phenyl]urea (PubChem CID 100665083) has the molecular formula C19H21FN4O3S and a molecular weight of 404.47 g/mol. Its IUPAC name is 1-[(2R)-1-cyanobutan-2-yl]-3-[4-fluoro-2-methyl-5-(phenylsulfamoyl)phenyl]urea.
| Compound Name | 1-[(2R)-1-cyanobutan-2-yl]-3-[4-fluoro-2-methyl-5-(phenylsulfamoyl)phenyl]urea |
|---|---|
| PubChem CID | 100665083 |
| Molecular Formula | C19H21FN4O3S |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | 1-[(2R)-1-cyanobutan-2-yl]-3-[4-fluoro-2-methyl-5-(phenylsulfamoyl)phenyl]urea |
| SMILES | CC[C@H](CC#N)NC(=O)Nc1cc(S(=O)(=O)Nc2ccccc2)c(F)cc1C |
| InChI | InChI=1S/C19H21FN4O3S/c1-3-14(9-10-21)22-19(25)23-17-12-18(16(20)11-13(17)2)28(26,27)24-15-7-5-4-6-8-15/h4-8,11-12,14,24H,3,9H2,1-2H3,(H2,22,23,25)/t14-/m1/s1 |
| InChIKey | SZKAZJTVTKJDBT-CQSZACIVSA-N |
| XLogP | 3.75 |
| TPSA | 111.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |