C17H15F2N3O3 — CID 129375104
1-[5-cyano-2-(difluoromethoxy)phenyl]-3-[(1S)-2-hydroxy-1-phenylethyl]urea (PubChem CID 129375104) has the molecular formula C17H15F2N3O3 and a molecular weight of 347.32 g/mol. Its IUPAC name is 1-[5-cyano-2-(difluoromethoxy)phenyl]-3-[(1S)-2-hydroxy-1-phenylethyl]urea.
| Compound Name | 1-[5-cyano-2-(difluoromethoxy)phenyl]-3-[(1S)-2-hydroxy-1-phenylethyl]urea |
|---|---|
| PubChem CID | 129375104 |
| Molecular Formula | C17H15F2N3O3 |
| Molecular Weight | 347.32 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 1-[5-cyano-2-(difluoromethoxy)phenyl]-3-[(1S)-2-hydroxy-1-phenylethyl]urea |
| SMILES | N#Cc1ccc(OC(F)F)c(NC(=O)N[C@H](CO)c2ccccc2)c1 |
| InChI | InChI=1S/C17H15F2N3O3/c18-16(19)25-15-7-6-11(9-20)8-13(15)21-17(24)22-14(10-23)12-4-2-1-3-5-12/h1-8,14,16,23H,10H2,(H2,21,22,24)/t14-/m1/s1 |
| InChIKey | WUXWVNHQUCEFAK-CQSZACIVSA-N |
| XLogP | 3.01 |
| TPSA | 94.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.32 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |