C17H25N3O — CID 122081064
3-amino-N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)cyclohexane-1-carboxamide (PubChem CID 122081064) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is 3-amino-N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)cyclohexane-1-carboxamide.
| Compound Name | 3-amino-N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 122081064 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | 3-amino-N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)cyclohexane-1-carboxamide |
| SMILES | Nc1ccc2c(c1)CCCC2NC(=O)C1CCCC(N)C1 |
| InChI | InChI=1S/C17H25N3O/c18-13-5-1-4-12(10-13)17(21)20-16-6-2-3-11-9-14(19)7-8-15(11)16/h7-9,12-13,16H,1-6,10,18-19H2,(H,20,21) |
| InChIKey | PAOIYAUJBKVCGC-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|