C18H23N5O — CID 131960556
1-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-3-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-yl)urea (PubChem CID 131960556) has the molecular formula C18H23N5O and a molecular weight of 325.42 g/mol. Its IUPAC name is 1-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-3-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-yl)urea.
| Compound Name | 1-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-3-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-yl)urea |
|---|---|
| PubChem CID | 131960556 |
| Molecular Formula | C18H23N5O |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | 1-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-3-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-yl)urea |
| SMILES | Nc1ccc2c(c1)CCCC2NC(=O)Nc1cc2n(n1)CCCC2 |
| InChI | InChI=1S/C18H23N5O/c19-13-7-8-15-12(10-13)4-3-6-16(15)20-18(24)21-17-11-14-5-1-2-9-23(14)22-17/h7-8,10-11,16H,1-6,9,19H2,(H2,20,21,22,24) |
| InChIKey | CJVFWNDMINBNJM-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 84.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|