C17H25F3N6O — CID 122081934
N'-[[1-hydroxy-3-(trifluoromethyl)cyclohexyl]methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide (PubChem CID 122081934) has the molecular formula C17H25F3N6O and a molecular weight of 386.42 g/mol. Its IUPAC name is N'-[[1-hydroxy-3-(trifluoromethyl)cyclohexyl]methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide.
| Compound Name | N'-[[1-hydroxy-3-(trifluoromethyl)cyclohexyl]methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 122081934 |
| Molecular Formula | C17H25F3N6O |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | N'-[[1-hydroxy-3-(trifluoromethyl)cyclohexyl]methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
| SMILES | N/C(=N\CC1(O)CCCC(C(F)(F)F)C1)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C17H25F3N6O/c18-17(19,20)13-3-1-4-16(27,11-13)12-24-14(21)25-7-9-26(10-8-25)15-22-5-2-6-23-15/h2,5-6,13,27H,1,3-4,7-12H2,(H2,21,24) |
| InChIKey | QXOLYJJWWPQZAI-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|