C16H19F4N3 — CID 122082045
1-cyclopropyl-3-[[1-[3-fluoro-5-(trifluoromethyl)phenyl]cyclopropyl]methyl]-2-methylguanidine (PubChem CID 122082045) has the molecular formula C16H19F4N3 and a molecular weight of 329.34 g/mol. Its IUPAC name is 1-cyclopropyl-3-[[1-[3-fluoro-5-(trifluoromethyl)phenyl]cyclopropyl]methyl]-2-methylguanidine.
| Compound Name | 1-cyclopropyl-3-[[1-[3-fluoro-5-(trifluoromethyl)phenyl]cyclopropyl]methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 122082045 |
| Molecular Formula | C16H19F4N3 |
| Molecular Weight | 329.34 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | 1-cyclopropyl-3-[[1-[3-fluoro-5-(trifluoromethyl)phenyl]cyclopropyl]methyl]-2-methylguanidine |
| SMILES | C/N=C(/NCC1(c2cc(F)cc(C(F)(F)F)c2)CC1)NC1CC1 |
| InChI | InChI=1S/C16H19F4N3/c1-21-14(23-13-2-3-13)22-9-15(4-5-15)10-6-11(16(18,19)20)8-12(17)7-10/h6-8,13H,2-5,9H2,1H3,(H2,21,22,23) |
| InChIKey | LOWISUPDGOFHTP-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.34 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|