C17H24N2O5 — CID 122085302
4-methyl-4-[[4-(oxolan-3-yloxy)phenyl]carbamoylamino]pentanoic acid (PubChem CID 122085302) has the molecular formula C17H24N2O5 and a molecular weight of 336.39 g/mol. Its IUPAC name is 4-methyl-4-[[4-(oxolan-3-yloxy)phenyl]carbamoylamino]pentanoic acid.
| Compound Name | 4-methyl-4-[[4-(oxolan-3-yloxy)phenyl]carbamoylamino]pentanoic acid |
|---|---|
| PubChem CID | 122085302 |
| Molecular Formula | C17H24N2O5 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 4-methyl-4-[[4-(oxolan-3-yloxy)phenyl]carbamoylamino]pentanoic acid |
| SMILES | CC(C)(CCC(=O)O)NC(=O)Nc1ccc(OC2CCOC2)cc1 |
| InChI | InChI=1S/C17H24N2O5/c1-17(2,9-7-15(20)21)19-16(22)18-12-3-5-13(6-4-12)24-14-8-10-23-11-14/h3-6,14H,7-11H2,1-2H3,(H,20,21)(H2,18,19,22) |
| InChIKey | ACMOZLLSJKVIIF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |