C19H19F3N2O3 — CID 126776533
1-[4-(oxolan-3-yloxy)phenyl]-3-[2-(2,2,2-trifluoroethyl)phenyl]urea (PubChem CID 126776533) has the molecular formula C19H19F3N2O3 and a molecular weight of 380.37 g/mol. Its IUPAC name is 1-[4-(oxolan-3-yloxy)phenyl]-3-[2-(2,2,2-trifluoroethyl)phenyl]urea.
| Compound Name | 1-[4-(oxolan-3-yloxy)phenyl]-3-[2-(2,2,2-trifluoroethyl)phenyl]urea |
|---|---|
| PubChem CID | 126776533 |
| Molecular Formula | C19H19F3N2O3 |
| Molecular Weight | 380.37 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 1-[4-(oxolan-3-yloxy)phenyl]-3-[2-(2,2,2-trifluoroethyl)phenyl]urea |
| SMILES | O=C(Nc1ccc(OC2CCOC2)cc1)Nc1ccccc1CC(F)(F)F |
| InChI | InChI=1S/C19H19F3N2O3/c20-19(21,22)11-13-3-1-2-4-17(13)24-18(25)23-14-5-7-15(8-6-14)27-16-9-10-26-12-16/h1-8,16H,9-12H2,(H2,23,24,25) |
| InChIKey | GEWBURZSSZUCIV-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.37 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |