C18H18F2N2O5S — CID 96542049
1-[3-(difluoromethylsulfonyl)phenyl]-3-[2-[(3S)-oxolan-3-yl]oxyphenyl]urea (PubChem CID 96542049) has the molecular formula C18H18F2N2O5S and a molecular weight of 412.41 g/mol. Its IUPAC name is 1-[3-(difluoromethylsulfonyl)phenyl]-3-[2-[(3S)-oxolan-3-yl]oxyphenyl]urea.
| Compound Name | 1-[3-(difluoromethylsulfonyl)phenyl]-3-[2-[(3S)-oxolan-3-yl]oxyphenyl]urea |
|---|---|
| PubChem CID | 96542049 |
| Molecular Formula | C18H18F2N2O5S |
| Molecular Weight | 412.41 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | 1-[3-(difluoromethylsulfonyl)phenyl]-3-[2-[(3S)-oxolan-3-yl]oxyphenyl]urea |
| SMILES | O=C(Nc1cccc(S(=O)(=O)C(F)F)c1)Nc1ccccc1O[C@H]1CCOC1 |
| InChI | InChI=1S/C18H18F2N2O5S/c19-17(20)28(24,25)14-5-3-4-12(10-14)21-18(23)22-15-6-1-2-7-16(15)27-13-8-9-26-11-13/h1-7,10,13,17H,8-9,11H2,(H2,21,22,23)/t13-/m0/s1 |
| InChIKey | GKIYZYCTTTYHKI-ZDUSSCGKSA-N |
| XLogP | 3.49 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.41 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |