C18H19BrN2O3 — CID 96542046
1-(3-bromo-2-methylphenyl)-3-[2-[(3R)-oxolan-3-yl]oxyphenyl]urea (PubChem CID 96542046) has the molecular formula C18H19BrN2O3 and a molecular weight of 391.27 g/mol. Its IUPAC name is 1-(3-bromo-2-methylphenyl)-3-[2-[(3R)-oxolan-3-yl]oxyphenyl]urea.
| Compound Name | 1-(3-bromo-2-methylphenyl)-3-[2-[(3R)-oxolan-3-yl]oxyphenyl]urea |
|---|---|
| PubChem CID | 96542046 |
| Molecular Formula | C18H19BrN2O3 |
| Molecular Weight | 391.27 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | 1-(3-bromo-2-methylphenyl)-3-[2-[(3R)-oxolan-3-yl]oxyphenyl]urea |
| SMILES | Cc1c(Br)cccc1NC(=O)Nc1ccccc1O[C@@H]1CCOC1 |
| InChI | InChI=1S/C18H19BrN2O3/c1-12-14(19)5-4-7-15(12)20-18(22)21-16-6-2-3-8-17(16)24-13-9-10-23-11-13/h2-8,13H,9-11H2,1H3,(H2,20,21,22)/t13-/m1/s1 |
| InChIKey | IPXCIUMWSZJVRW-CYBMUJFWSA-N |
| XLogP | 4.57 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.27 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |