C17H22F2N2O4S — CID 126776905
4-(cyclobutylmethyl)-N-[3-(difluoromethylsulfonyl)phenyl]morpholine-3-carboxamide (PubChem CID 126776905) has the molecular formula C17H22F2N2O4S and a molecular weight of 388.44 g/mol. Its IUPAC name is 4-(cyclobutylmethyl)-N-[3-(difluoromethylsulfonyl)phenyl]morpholine-3-carboxamide.
| Compound Name | 4-(cyclobutylmethyl)-N-[3-(difluoromethylsulfonyl)phenyl]morpholine-3-carboxamide |
|---|---|
| PubChem CID | 126776905 |
| Molecular Formula | C17H22F2N2O4S |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | 4-(cyclobutylmethyl)-N-[3-(difluoromethylsulfonyl)phenyl]morpholine-3-carboxamide |
| SMILES | O=C(Nc1cccc(S(=O)(=O)C(F)F)c1)C1COCCN1CC1CCC1 |
| InChI | InChI=1S/C17H22F2N2O4S/c18-17(19)26(23,24)14-6-2-5-13(9-14)20-16(22)15-11-25-8-7-21(15)10-12-3-1-4-12/h2,5-6,9,12,15,17H,1,3-4,7-8,10-11H2,(H,20,22) |
| InChIKey | GJSFBXZOEDKVPY-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |