C17H25N3O5 — CID 122086227
3-[[4-(dimethylcarbamoyl)-2-ethoxyphenyl]carbamoyl-methylamino]-2-methylpropanoic acid (PubChem CID 122086227) has the molecular formula C17H25N3O5 and a molecular weight of 351.40 g/mol. Its IUPAC name is 3-[[4-(dimethylcarbamoyl)-2-ethoxyphenyl]carbamoyl-methylamino]-2-methylpropanoic acid.
| Compound Name | 3-[[4-(dimethylcarbamoyl)-2-ethoxyphenyl]carbamoyl-methylamino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 122086227 |
| Molecular Formula | C17H25N3O5 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | 3-[[4-(dimethylcarbamoyl)-2-ethoxyphenyl]carbamoyl-methylamino]-2-methylpropanoic acid |
| SMILES | CCOc1cc(C(=O)N(C)C)ccc1NC(=O)N(C)CC(C)C(=O)O |
| InChI | InChI=1S/C17H25N3O5/c1-6-25-14-9-12(15(21)19(3)4)7-8-13(14)18-17(24)20(5)10-11(2)16(22)23/h7-9,11H,6,10H2,1-5H3,(H,18,24)(H,22,23) |
| InChIKey | CEQUMSSIMYFWPT-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |