C14H19N3O6 — CID 122092535
3-[(2-ethoxy-5-nitrophenyl)carbamoyl-methylamino]-2-methylpropanoic acid (PubChem CID 122092535) has the molecular formula C14H19N3O6 and a molecular weight of 325.32 g/mol. Its IUPAC name is 3-[(2-ethoxy-5-nitrophenyl)carbamoyl-methylamino]-2-methylpropanoic acid.
| Compound Name | 3-[(2-ethoxy-5-nitrophenyl)carbamoyl-methylamino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 122092535 |
| Molecular Formula | C14H19N3O6 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 3-[(2-ethoxy-5-nitrophenyl)carbamoyl-methylamino]-2-methylpropanoic acid |
| SMILES | CCOc1ccc([N+](=O)[O-])cc1NC(=O)N(C)CC(C)C(=O)O |
| InChI | InChI=1S/C14H19N3O6/c1-4-23-12-6-5-10(17(21)22)7-11(12)15-14(20)16(3)8-9(2)13(18)19/h5-7,9H,4,8H2,1-3H3,(H,15,20)(H,18,19) |
| InChIKey | AZPRGPUYUHMMAJ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 122.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|