C19H27N5O3 — CID 122089922
4-methyl-4-[[1-(4-methyl-2-pyridinyl)-5-propylpyrazol-4-yl]carbamoylamino]pentanoic acid (PubChem CID 122089922) has the molecular formula C19H27N5O3 and a molecular weight of 373.46 g/mol. Its IUPAC name is 4-methyl-4-[[1-(4-methyl-2-pyridinyl)-5-propylpyrazol-4-yl]carbamoylamino]pentanoic acid.
| Compound Name | 4-methyl-4-[[1-(4-methyl-2-pyridinyl)-5-propylpyrazol-4-yl]carbamoylamino]pentanoic acid |
|---|---|
| PubChem CID | 122089922 |
| Molecular Formula | C19H27N5O3 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.21 |
| IUPAC Name | 4-methyl-4-[[1-(4-methyl-2-pyridinyl)-5-propylpyrazol-4-yl]carbamoylamino]pentanoic acid |
| SMILES | CCCc1c(NC(=O)NC(C)(C)CCC(=O)O)cnn1-c1cc(C)ccn1 |
| InChI | InChI=1S/C19H27N5O3/c1-5-6-15-14(12-21-24(15)16-11-13(2)8-10-20-16)22-18(27)23-19(3,4)9-7-17(25)26/h8,10-12H,5-7,9H2,1-4H3,(H,25,26)(H2,22,23,27) |
| InChIKey | WNVQNRDXPOISRF-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 109.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |