C20H28N4O3 — CID 122091735
4-methyl-4-[[1-(3-methylphenyl)-5-propylpyrazol-4-yl]carbamoylamino]pentanoic acid (PubChem CID 122091735) has the molecular formula C20H28N4O3 and a molecular weight of 372.47 g/mol. Its IUPAC name is 4-methyl-4-[[1-(3-methylphenyl)-5-propylpyrazol-4-yl]carbamoylamino]pentanoic acid.
| Compound Name | 4-methyl-4-[[1-(3-methylphenyl)-5-propylpyrazol-4-yl]carbamoylamino]pentanoic acid |
|---|---|
| PubChem CID | 122091735 |
| Molecular Formula | C20H28N4O3 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | 4-methyl-4-[[1-(3-methylphenyl)-5-propylpyrazol-4-yl]carbamoylamino]pentanoic acid |
| SMILES | CCCc1c(NC(=O)NC(C)(C)CCC(=O)O)cnn1-c1cccc(C)c1 |
| InChI | InChI=1S/C20H28N4O3/c1-5-7-17-16(13-21-24(17)15-9-6-8-14(2)12-15)22-19(27)23-20(3,4)11-10-18(25)26/h6,8-9,12-13H,5,7,10-11H2,1-4H3,(H,25,26)(H2,22,23,27) |
| InChIKey | UNTZGHYJPGYOIA-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |