C17H30N4O3 — CID 122091426
4-[(1-butyl-5-propan-2-ylpyrazol-4-yl)carbamoylamino]-4-methylpentanoic acid (PubChem CID 122091426) has the molecular formula C17H30N4O3 and a molecular weight of 338.45 g/mol. Its IUPAC name is 4-[(1-butyl-5-propan-2-ylpyrazol-4-yl)carbamoylamino]-4-methylpentanoic acid.
| Compound Name | 4-[(1-butyl-5-propan-2-ylpyrazol-4-yl)carbamoylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 122091426 |
| Molecular Formula | C17H30N4O3 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.23 |
| IUPAC Name | 4-[(1-butyl-5-propan-2-ylpyrazol-4-yl)carbamoylamino]-4-methylpentanoic acid |
| SMILES | CCCCn1ncc(NC(=O)NC(C)(C)CCC(=O)O)c1C(C)C |
| InChI | InChI=1S/C17H30N4O3/c1-6-7-10-21-15(12(2)3)13(11-18-21)19-16(24)20-17(4,5)9-8-14(22)23/h11-12H,6-10H2,1-5H3,(H,22,23)(H2,19,20,24) |
| InChIKey | NCURLSWXUSNGEW-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |