C11H17N3O3S — CID 122094893
4-[(4-propan-2-yl-1,3-thiazol-5-yl)carbamoylamino]butanoic acid (PubChem CID 122094893) has the molecular formula C11H17N3O3S and a molecular weight of 271.34 g/mol. Its IUPAC name is 4-[(4-propan-2-yl-1,3-thiazol-5-yl)carbamoylamino]butanoic acid.
| Compound Name | 4-[(4-propan-2-yl-1,3-thiazol-5-yl)carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 122094893 |
| Molecular Formula | C11H17N3O3S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 4-[(4-propan-2-yl-1,3-thiazol-5-yl)carbamoylamino]butanoic acid |
| SMILES | CC(C)c1ncsc1NC(=O)NCCCC(=O)O |
| InChI | InChI=1S/C11H17N3O3S/c1-7(2)9-10(18-6-13-9)14-11(17)12-5-3-4-8(15)16/h6-7H,3-5H2,1-2H3,(H,15,16)(H2,12,14,17) |
| InChIKey | ZTEPVVCMGMPDDK-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|