C14H16N4 — CID 122095761
N'-(quinolin-6-ylmethyl)azetidine-1-carboximidamide (PubChem CID 122095761) has the molecular formula C14H16N4 and a molecular weight of 240.31 g/mol. Its IUPAC name is N'-(quinolin-6-ylmethyl)azetidine-1-carboximidamide.
| Compound Name | N'-(quinolin-6-ylmethyl)azetidine-1-carboximidamide |
|---|---|
| PubChem CID | 122095761 |
| Molecular Formula | C14H16N4 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | N'-(quinolin-6-ylmethyl)azetidine-1-carboximidamide |
| SMILES | N/C(=N\Cc1ccc2ncccc2c1)N1CCC1 |
| InChI | InChI=1S/C14H16N4/c15-14(18-7-2-8-18)17-10-11-4-5-13-12(9-11)3-1-6-16-13/h1,3-6,9H,2,7-8,10H2,(H2,15,17) |
| InChIKey | XPLKNFURNSBGOX-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 54.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|