C12H21N3 — CID 122096135
N-(4,4-dimethylpent-1-yn-3-yl)-1-methyl-5,6-dihydro-4H-pyrimidin-2-amine (PubChem CID 122096135) has the molecular formula C12H21N3 and a molecular weight of 207.32 g/mol. Its IUPAC name is N-(4,4-dimethylpent-1-yn-3-yl)-1-methyl-5,6-dihydro-4H-pyrimidin-2-amine.
| Compound Name | N-(4,4-dimethylpent-1-yn-3-yl)-1-methyl-5,6-dihydro-4H-pyrimidin-2-amine |
|---|---|
| PubChem CID | 122096135 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | N-(4,4-dimethylpent-1-yn-3-yl)-1-methyl-5,6-dihydro-4H-pyrimidin-2-amine |
| SMILES | C#CC(NC1=NCCCN1C)C(C)(C)C |
| InChI | InChI=1S/C12H21N3/c1-6-10(12(2,3)4)14-11-13-8-7-9-15(11)5/h1,10H,7-9H2,2-5H3,(H,13,14) |
| InChIKey | KNYMJBSBGRWFCE-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|