C17H21BrN4O — CID 122096966
2-benzyl-3-[2-(5-bromo-2-oxo-1-pyridinyl)ethyl]-1,1-dimethylguanidine (PubChem CID 122096966) has the molecular formula C17H21BrN4O and a molecular weight of 377.29 g/mol. Its IUPAC name is 2-benzyl-3-[2-(5-bromo-2-oxo-1-pyridinyl)ethyl]-1,1-dimethylguanidine.
| Compound Name | 2-benzyl-3-[2-(5-bromo-2-oxo-1-pyridinyl)ethyl]-1,1-dimethylguanidine |
|---|---|
| PubChem CID | 122096966 |
| Molecular Formula | C17H21BrN4O |
| Molecular Weight | 377.29 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | 2-benzyl-3-[2-(5-bromo-2-oxo-1-pyridinyl)ethyl]-1,1-dimethylguanidine |
| SMILES | CN(C)/C(=N\Cc1ccccc1)NCCn1cc(Br)ccc1=O |
| InChI | InChI=1S/C17H21BrN4O/c1-21(2)17(20-12-14-6-4-3-5-7-14)19-10-11-22-13-15(18)8-9-16(22)23/h3-9,13H,10-12H2,1-2H3,(H,19,20) |
| InChIKey | BHVBUZHNNUHAFG-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 49.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.29 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|