C18H25N3O — CID 122098926
1-(2,3-dihydro-1H-inden-5-yl)-2-(3-methoxyspiro[3.3]heptan-1-yl)guanidine (PubChem CID 122098926) has the molecular formula C18H25N3O and a molecular weight of 299.42 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-5-yl)-2-(3-methoxyspiro[3.3]heptan-1-yl)guanidine.
| Compound Name | 1-(2,3-dihydro-1H-inden-5-yl)-2-(3-methoxyspiro[3.3]heptan-1-yl)guanidine |
|---|---|
| PubChem CID | 122098926 |
| Molecular Formula | C18H25N3O |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-5-yl)-2-(3-methoxyspiro[3.3]heptan-1-yl)guanidine |
| SMILES | COC1CC(/N=C(\N)Nc2ccc3c(c2)CCC3)C12CCC2 |
| InChI | InChI=1S/C18H25N3O/c1-22-16-11-15(18(16)8-3-9-18)21-17(19)20-14-7-6-12-4-2-5-13(12)10-14/h6-7,10,15-16H,2-5,8-9,11H2,1H3,(H3,19,20,21) |
| InChIKey | DHBGQLDZFMRTTJ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|