C19H22BrN3 — CID 22675654
1,2-bis(2,3-dihydro-1H-inden-5-yl)guanidine;hydrobromide (PubChem CID 22675654) has the molecular formula C19H22BrN3 and a molecular weight of 372.31 g/mol. Its IUPAC name is 1,2-bis(2,3-dihydro-1H-inden-5-yl)guanidine;hydrobromide.
| Compound Name | 1,2-bis(2,3-dihydro-1H-inden-5-yl)guanidine;hydrobromide |
|---|---|
| PubChem CID | 22675654 |
| Molecular Formula | C19H22BrN3 |
| Molecular Weight | 372.31 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | 1,2-bis(2,3-dihydro-1H-inden-5-yl)guanidine;hydrobromide |
| SMILES | Br.N/C(=N\c1ccc2c(c1)CCC2)Nc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C19H21N3.BrH/c20-19(21-17-9-7-13-3-1-5-15(13)11-17)22-18-10-8-14-4-2-6-16(14)12-18;/h7-12H,1-6H2,(H3,20,21,22);1H |
| InChIKey | XYWSPECJCZTNDN-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.31 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|