C15H29N3O — CID 122099406
1-cyclopropyl-2-[(1R,3S)-2,2-dimethyl-3-[(2-methylpropan-2-yl)oxy]cyclobutyl]-1-methylguanidine (PubChem CID 122099406) has the molecular formula C15H29N3O and a molecular weight of 267.42 g/mol. Its IUPAC name is 1-cyclopropyl-2-[(1R,3S)-2,2-dimethyl-3-[(2-methylpropan-2-yl)oxy]cyclobutyl]-1-methylguanidine.
| Compound Name | 1-cyclopropyl-2-[(1R,3S)-2,2-dimethyl-3-[(2-methylpropan-2-yl)oxy]cyclobutyl]-1-methylguanidine |
|---|---|
| PubChem CID | 122099406 |
| Molecular Formula | C15H29N3O |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.23 |
| IUPAC Name | 1-cyclopropyl-2-[(1R,3S)-2,2-dimethyl-3-[(2-methylpropan-2-yl)oxy]cyclobutyl]-1-methylguanidine |
| SMILES | CN(/C(N)=N/[C@@H]1C[C@H](OC(C)(C)C)C1(C)C)C1CC1 |
| InChI | InChI=1S/C15H29N3O/c1-14(2,3)19-12-9-11(15(12,4)5)17-13(16)18(6)10-7-8-10/h10-12H,7-9H2,1-6H3,(H2,16,17)/t11-,12+/m1/s1 |
| InChIKey | DGCQDUDOWZCJAG-NEPJUHHUSA-N |
| XLogP | 2.38 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|