C12H21N3O4S — CID 122106114
1-[2-cyanopropyl(methyl)sulfamoyl]-5-methylpiperidine-3-carboxylic acid (PubChem CID 122106114) has the molecular formula C12H21N3O4S and a molecular weight of 303.38 g/mol. Its IUPAC name is 1-[2-cyanopropyl(methyl)sulfamoyl]-5-methylpiperidine-3-carboxylic acid.
| Compound Name | 1-[2-cyanopropyl(methyl)sulfamoyl]-5-methylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122106114 |
| Molecular Formula | C12H21N3O4S |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 1-[2-cyanopropyl(methyl)sulfamoyl]-5-methylpiperidine-3-carboxylic acid |
| SMILES | CC(C#N)CN(C)S(=O)(=O)N1CC(C)CC(C(=O)O)C1 |
| InChI | InChI=1S/C12H21N3O4S/c1-9-4-11(12(16)17)8-15(7-9)20(18,19)14(3)6-10(2)5-13/h9-11H,4,6-8H2,1-3H3,(H,16,17) |
| InChIKey | BLGQVDNJXJEXPS-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 101.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |