C13H25NO6S2 — CID 122106216
5-methyl-1-(3-methyl-3-methylsulfonylbutyl)sulfonylpiperidine-3-carboxylic acid (PubChem CID 122106216) has the molecular formula C13H25NO6S2 and a molecular weight of 355.48 g/mol. Its IUPAC name is 5-methyl-1-(3-methyl-3-methylsulfonylbutyl)sulfonylpiperidine-3-carboxylic acid.
| Compound Name | 5-methyl-1-(3-methyl-3-methylsulfonylbutyl)sulfonylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122106216 |
| Molecular Formula | C13H25NO6S2 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 5-methyl-1-(3-methyl-3-methylsulfonylbutyl)sulfonylpiperidine-3-carboxylic acid |
| SMILES | CC1CC(C(=O)O)CN(S(=O)(=O)CCC(C)(C)S(C)(=O)=O)C1 |
| InChI | InChI=1S/C13H25NO6S2/c1-10-7-11(12(15)16)9-14(8-10)22(19,20)6-5-13(2,3)21(4,17)18/h10-11H,5-9H2,1-4H3,(H,15,16) |
| InChIKey | WHBUGMHBCKBDJX-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 108.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |